About 4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol
4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol (PubChem CID 2990088) has the molecular formula C17H23NO
and a molecular weight of 257.37 g/mol. Its IUPAC name is 4-(benzylamino)adamantan-1-ol.
Molecular Properties
| Compound Name | 4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol |
| PubChem CID | 2990088 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 4-(benzylamino)adamantan-1-ol |
| SMILES | C1C2CC3CC(C2)(CC1C3NCC4=CC=CC=C4)O |
| InChI | InChI=1S/C17H23NO/c19-17-8-13-6-14(9-17)16(15(7-13)10-17)18-11-12-4-2-1-3-5-12/h1-5,13-16,18-19H,6-11H2 |
| InChIKey | AFYONXZDFSWICD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | 320 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol?
The IUPAC name of 4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol (CID 2990088) is 4-(benzylamino)adamantan-1-ol.
What is the SMILES notation for 4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol?
The canonical SMILES for 4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol is C1C2CC3CC(C2)(CC1C3NCC4=CC=CC=C4)O.
What is the InChIKey of 4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol?
The InChIKey is AFYONXZDFSWICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO/c19-17-8-13-6-14(9-17)16(15(7-13)10-17)18-11-12-4-2-1-3-5-12/h1-5,13-16,18-19H,6-11H2.
What are the key properties of 4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol?
4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol has a molecular weight of 257.37 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(Benzylamino)tricyclo[3.3.1.1~3,7~]decan-1-ol is sourced from PubChem (CID 2990088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).