1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid

C12H9FN2O4 — CID 2990121

IUPAC1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)n(Cc2ccc(F)cc2)n1
InChIInChI=1S/C12H9FN2O4/c13-8-3-1-7(2-4-8)6-15-10(12(18)19)5-9(14-15)11(16)17/h1-5H,6H2,(H,16,17)(H,18,19)
InChIKeyYYCGCLWGMQYTDZ-UHFFFAOYSA-N
MW264.21 g/mol
LogP1.47
Rot. Bonds4

About 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid

1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid (PubChem CID 2990121) has the molecular formula C12H9FN2O4 and a molecular weight of 264.21 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid.

Molecular Properties

Compound Name1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid
PubChem CID2990121
Molecular FormulaC12H9FN2O4
Molecular Weight264.21 g/mol
Exact Mass264.05
IUPAC Name1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)n(Cc2ccc(F)cc2)n1
InChIInChI=1S/C12H9FN2O4/c13-8-3-1-7(2-4-8)6-15-10(12(18)19)5-9(14-15)11(16)17/h1-5H,6H2,(H,16,17)(H,18,19)
InChIKeyYYCGCLWGMQYTDZ-UHFFFAOYSA-N
XLogP1.47
TPSA92.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.21
LogP ≤ 51.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid?
The IUPAC name of 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid (CID 2990121) is 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid.
What is the SMILES notation for 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid?
The canonical SMILES for 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid is O=C(O)c1cc(C(=O)O)n(Cc2ccc(F)cc2)n1.
What is the InChIKey of 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid?
The InChIKey is YYCGCLWGMQYTDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2O4/c13-8-3-1-7(2-4-8)6-15-10(12(18)19)5-9(14-15)11(16)17/h1-5H,6H2,(H,16,17)(H,18,19).
What are the key properties of 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid?
1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid has a molecular weight of 264.21 g/mol, XLogP of 1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-fluorophenyl)methyl]pyrazole-3,5-dicarboxylic acid is sourced from PubChem (CID 2990121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).