About 1-benzyl-1,3,3-triethylurea
1-benzyl-1,3,3-triethylurea (PubChem CID 2990170) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-benzyl-1,3,3-triethylurea.
Molecular Properties
| Compound Name | 1-benzyl-1,3,3-triethylurea |
| PubChem CID | 2990170 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-benzyl-1,3,3-triethylurea |
| SMILES | CCN(CC)C(=O)N(CC)Cc1ccccc1 |
| InChI | InChI=1S/C14H22N2O/c1-4-15(5-2)14(17)16(6-3)12-13-10-8-7-9-11-13/h7-11H,4-6,12H2,1-3H3 |
| InChIKey | ICZCGQYOKCNCAN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-1,3,3-triethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1,3,3-triethylurea?
The IUPAC name of 1-benzyl-1,3,3-triethylurea (CID 2990170) is 1-benzyl-1,3,3-triethylurea.
What is the SMILES notation for 1-benzyl-1,3,3-triethylurea?
The canonical SMILES for 1-benzyl-1,3,3-triethylurea is CCN(CC)C(=O)N(CC)Cc1ccccc1.
What is the InChIKey of 1-benzyl-1,3,3-triethylurea?
The InChIKey is ICZCGQYOKCNCAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O/c1-4-15(5-2)14(17)16(6-3)12-13-10-8-7-9-11-13/h7-11H,4-6,12H2,1-3H3.
What are the key properties of 1-benzyl-1,3,3-triethylurea?
1-benzyl-1,3,3-triethylurea has a molecular weight of 234.34 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1,3,3-triethylurea is sourced from PubChem (CID 2990170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).