About 1-N-benzoylpiperidine-1,4-dicarboxamide
1-N-benzoylpiperidine-1,4-dicarboxamide (PubChem CID 2990374) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-N-benzoylpiperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-benzoylpiperidine-1,4-dicarboxamide |
| PubChem CID | 2990374 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-N-benzoylpiperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C14H17N3O3/c15-12(18)10-6-8-17(9-7-10)14(20)16-13(19)11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H2,15,18)(H,16,19,20) |
| InChIKey | QQSNOGUYGYARCX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-benzoylpiperidine-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-benzoylpiperidine-1,4-dicarboxamide?
The IUPAC name of 1-N-benzoylpiperidine-1,4-dicarboxamide (CID 2990374) is 1-N-benzoylpiperidine-1,4-dicarboxamide.
What is the SMILES notation for 1-N-benzoylpiperidine-1,4-dicarboxamide?
The canonical SMILES for 1-N-benzoylpiperidine-1,4-dicarboxamide is NC(=O)C1CCN(C(=O)NC(=O)c2ccccc2)CC1.
What is the InChIKey of 1-N-benzoylpiperidine-1,4-dicarboxamide?
The InChIKey is QQSNOGUYGYARCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c15-12(18)10-6-8-17(9-7-10)14(20)16-13(19)11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H2,15,18)(H,16,19,20).
What are the key properties of 1-N-benzoylpiperidine-1,4-dicarboxamide?
1-N-benzoylpiperidine-1,4-dicarboxamide has a molecular weight of 275.31 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-benzoylpiperidine-1,4-dicarboxamide is sourced from PubChem (CID 2990374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).