About [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone
[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone (PubChem CID 2990880) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone.
Molecular Properties
| Compound Name | [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone |
| PubChem CID | 2990880 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone |
| SMILES | COc1ccc(C2=NN(C(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-13-3-5-15(6-4-13)18(21)20-12-11-17(19-20)14-7-9-16(22-2)10-8-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | VBPKJHVGMWLKMH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone?
The IUPAC name of [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone (CID 2990880) is [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone.
What is the SMILES notation for [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone?
The canonical SMILES for [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone is COc1ccc(C2=NN(C(=O)c3ccc(C)cc3)CC2)cc1.
What is the InChIKey of [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone?
The InChIKey is VBPKJHVGMWLKMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-13-3-5-15(6-4-13)18(21)20-12-11-17(19-20)14-7-9-16(22-2)10-8-14/h3-10H,11-12H2,1-2H3.
What are the key properties of [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone?
[5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone has a molecular weight of 294.35 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone is sourced from PubChem (CID 2990880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).