About N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide
N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide (PubChem CID 2991000) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide |
| PubChem CID | 2991000 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C12H24N2O/c1-5-13(6-2)12(15)14-8-10(3)7-11(4)9-14/h10-11H,5-9H2,1-4H3 |
| InChIKey | GTVUMRKCLOXJLX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide?
The IUPAC name of N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide (CID 2991000) is N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide.
What is the SMILES notation for N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide?
The canonical SMILES for N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide is CCN(CC)C(=O)N1CC(C)CC(C)C1.
What is the InChIKey of N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide?
The InChIKey is GTVUMRKCLOXJLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-5-13(6-2)12(15)14-8-10(3)7-11(4)9-14/h10-11H,5-9H2,1-4H3.
What are the key properties of N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide?
N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide has a molecular weight of 212.34 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide is sourced from PubChem (CID 2991000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).