About 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile
2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile (PubChem CID 2991085) has the molecular formula C12H10N2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile.
Molecular Properties
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile |
| PubChem CID | 2991085 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile |
| SMILES | Cc1nc(C(C#N)c2ccccc2)cs1 |
| InChI | InChI=1S/C12H10N2S/c1-9-14-12(8-15-9)11(7-13)10-5-3-2-4-6-10/h2-6,8,11H,1H3 |
| InChIKey | HJFPRMHVHXBKFI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile?
The IUPAC name of 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile (CID 2991085) is 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile.
What is the SMILES notation for 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile?
The canonical SMILES for 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile is Cc1nc(C(C#N)c2ccccc2)cs1.
What is the InChIKey of 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile?
The InChIKey is HJFPRMHVHXBKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2S/c1-9-14-12(8-15-9)11(7-13)10-5-3-2-4-6-10/h2-6,8,11H,1H3.
What are the key properties of 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile?
2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile has a molecular weight of 214.29 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-thiazol-4-yl)-2-phenylacetonitrile is sourced from PubChem (CID 2991085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).