C20H19FN6O2 — CID 2991105
N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 2991105) has the molecular formula C20H19FN6O2 and a molecular weight of 394.41 g/mol. Its IUPAC name is N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 2991105 |
| Molecular Formula | C20H19FN6O2 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C20H19FN6O2/c21-17-4-2-1-3-16(17)20(29)27-11-9-26(10-12-27)15-7-5-14(6-8-15)24-19(28)18-22-13-23-25-18/h1-8,13H,9-12H2,(H,24,28)(H,22,23,25) |
| InChIKey | GLGAFECNTZWTEW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|