C15H16Cl3N3O3 — CID 2991324
2,2,2-trichloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-propan-2-ylacetamide (PubChem CID 2991324) has the molecular formula C15H16Cl3N3O3 and a molecular weight of 392.67 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-propan-2-ylacetamide.
| Compound Name | 2,2,2-trichloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 2991324 |
| Molecular Formula | C15H16Cl3N3O3 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 2,2,2-trichloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-propan-2-ylacetamide |
| SMILES | COc1ccc(-c2noc(CN(C(=O)C(Cl)(Cl)Cl)C(C)C)n2)cc1 |
| InChI | InChI=1S/C15H16Cl3N3O3/c1-9(2)21(14(22)15(16,17)18)8-12-19-13(20-24-12)10-4-6-11(23-3)7-5-10/h4-7,9H,8H2,1-3H3 |
| InChIKey | WUJWPTYLHDJFSW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|