C27H32N6O3 — CID 2991940
8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione (PubChem CID 2991940) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione.
| Compound Name | 8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 2991940 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione |
| SMILES | COc1ccc(N2CCN(Cc3nc4c(c(=O)n(C)c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 |
| InChI | InChI=1S/C27H32N6O3/c1-19-6-5-7-20(16-19)17-33-23(28-25-24(33)26(34)30(3)27(35)29(25)2)18-31-12-14-32(15-13-31)21-8-10-22(36-4)11-9-21/h5-11,16H,12-15,17-18H2,1-4H3 |
| InChIKey | SXYUSNJQYPAVAP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 77.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|