About 2-butoxy-5-nitrobenzoic acid
2-butoxy-5-nitrobenzoic acid (PubChem CID 2992256) has the molecular formula C11H13NO5
and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-butoxy-5-nitrobenzoic acid.
Molecular Properties
| Compound Name | 2-butoxy-5-nitrobenzoic acid |
| PubChem CID | 2992256 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-butoxy-5-nitrobenzoic acid |
| SMILES | CCCCOc1ccc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C11H13NO5/c1-2-3-6-17-10-5-4-8(12(15)16)7-9(10)11(13)14/h4-5,7H,2-3,6H2,1H3,(H,13,14) |
| InChIKey | WBSCBTJMYWQFTH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-5-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-5-nitrobenzoic acid?
The IUPAC name of 2-butoxy-5-nitrobenzoic acid (CID 2992256) is 2-butoxy-5-nitrobenzoic acid.
What is the SMILES notation for 2-butoxy-5-nitrobenzoic acid?
The canonical SMILES for 2-butoxy-5-nitrobenzoic acid is CCCCOc1ccc([N+](=O)[O-])cc1C(=O)O.
What is the InChIKey of 2-butoxy-5-nitrobenzoic acid?
The InChIKey is WBSCBTJMYWQFTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO5/c1-2-3-6-17-10-5-4-8(12(15)16)7-9(10)11(13)14/h4-5,7H,2-3,6H2,1H3,(H,13,14).
What are the key properties of 2-butoxy-5-nitrobenzoic acid?
2-butoxy-5-nitrobenzoic acid has a molecular weight of 239.23 g/mol, XLogP of 2.47, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-5-nitrobenzoic acid is sourced from PubChem (CID 2992256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).