C14H13Cl2N3O4S — CID 2992367
5-chloro-N-(5-chloro-2-methoxyphenyl)-2-ethylsulfonylpyrimidine-4-carboxamide (PubChem CID 2992367) has the molecular formula C14H13Cl2N3O4S and a molecular weight of 390.25 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-methoxyphenyl)-2-ethylsulfonylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(5-chloro-2-methoxyphenyl)-2-ethylsulfonylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 2992367 |
| Molecular Formula | C14H13Cl2N3O4S |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-methoxyphenyl)-2-ethylsulfonylpyrimidine-4-carboxamide |
| SMILES | CCS(=O)(=O)c1ncc(Cl)c(C(=O)Nc2cc(Cl)ccc2OC)n1 |
| InChI | InChI=1S/C14H13Cl2N3O4S/c1-3-24(21,22)14-17-7-9(16)12(19-14)13(20)18-10-6-8(15)4-5-11(10)23-2/h4-7H,3H2,1-2H3,(H,18,20) |
| InChIKey | MFLOSHLLPQYSMC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |