About 9-chlorobenzimidazolo[2,1-a]phthalazine
9-chlorobenzimidazolo[2,1-a]phthalazine (PubChem CID 2992478) has the molecular formula C14H8ClN3
and a molecular weight of 253.69 g/mol. Its IUPAC name is 9-chlorobenzimidazolo[2,1-a]phthalazine.
Molecular Properties
| Compound Name | 9-chlorobenzimidazolo[2,1-a]phthalazine |
| PubChem CID | 2992478 |
| Molecular Formula | C14H8ClN3 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 9-chlorobenzimidazolo[2,1-a]phthalazine |
| SMILES | Clc1ccc2nc3c4ccccc4cnn3c2c1 |
| InChI | InChI=1S/C14H8ClN3/c15-10-5-6-12-13(7-10)18-14(17-12)11-4-2-1-3-9(11)8-16-18/h1-8H |
| InChIKey | VSXYBFOEHRWGRA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-chlorobenzimidazolo[2,1-a]phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chlorobenzimidazolo[2,1-a]phthalazine?
The IUPAC name of 9-chlorobenzimidazolo[2,1-a]phthalazine (CID 2992478) is 9-chlorobenzimidazolo[2,1-a]phthalazine.
What is the SMILES notation for 9-chlorobenzimidazolo[2,1-a]phthalazine?
The canonical SMILES for 9-chlorobenzimidazolo[2,1-a]phthalazine is Clc1ccc2nc3c4ccccc4cnn3c2c1.
What is the InChIKey of 9-chlorobenzimidazolo[2,1-a]phthalazine?
The InChIKey is VSXYBFOEHRWGRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClN3/c15-10-5-6-12-13(7-10)18-14(17-12)11-4-2-1-3-9(11)8-16-18/h1-8H.
What are the key properties of 9-chlorobenzimidazolo[2,1-a]phthalazine?
9-chlorobenzimidazolo[2,1-a]phthalazine has a molecular weight of 253.69 g/mol, XLogP of 3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chlorobenzimidazolo[2,1-a]phthalazine is sourced from PubChem (CID 2992478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).