About 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one
4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one (PubChem CID 2992745) has the molecular formula C19H15NO2
and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one.
Molecular Properties
| Compound Name | 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one |
| PubChem CID | 2992745 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one |
| SMILES | O=C1CC(c2cccc(O)c2)c2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C19H15NO2/c21-14-6-3-5-13(10-14)17-11-18(22)20-19-15-7-2-1-4-12(15)8-9-16(17)19/h1-10,17,21H,11H2,(H,20,22) |
| InChIKey | SCSAEXJBNFFFFE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one?
The IUPAC name of 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one (CID 2992745) is 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one.
What is the SMILES notation for 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one?
The canonical SMILES for 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one is O=C1CC(c2cccc(O)c2)c2ccc3ccccc3c2N1.
What is the InChIKey of 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one?
The InChIKey is SCSAEXJBNFFFFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO2/c21-14-6-3-5-13(10-14)17-11-18(22)20-19-15-7-2-1-4-12(15)8-9-16(17)19/h1-10,17,21H,11H2,(H,20,22).
What are the key properties of 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one?
4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one has a molecular weight of 289.33 g/mol, XLogP of 4.02, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-hydroxyphenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one is sourced from PubChem (CID 2992745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).