About phenyl pentanoate
phenyl pentanoate (PubChem CID 29950) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is phenyl pentanoate.
Molecular Properties
| Compound Name | phenyl pentanoate |
| PubChem CID | 29950 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | phenyl pentanoate |
| SMILES | CCCCC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-2-3-9-11(12)13-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3 |
| InChIKey | MVIMPQVBUPCHEV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl pentanoate?
The IUPAC name of phenyl pentanoate (CID 29950) is phenyl pentanoate.
What is the SMILES notation for phenyl pentanoate?
The canonical SMILES for phenyl pentanoate is CCCCC(=O)Oc1ccccc1.
What is the InChIKey of phenyl pentanoate?
The InChIKey is MVIMPQVBUPCHEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-2-3-9-11(12)13-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3.
What are the key properties of phenyl pentanoate?
phenyl pentanoate has a molecular weight of 178.23 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl pentanoate is sourced from PubChem (CID 29950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).