C10H8F5NO — CID 2995078
2,2,3,3-tetrafluoro-N-(2-fluoro-5-methylphenyl)propanamide (PubChem CID 2995078) has the molecular formula C10H8F5NO and a molecular weight of 253.17 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(2-fluoro-5-methylphenyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(2-fluoro-5-methylphenyl)propanamide |
|---|---|
| PubChem CID | 2995078 |
| Molecular Formula | C10H8F5NO |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(2-fluoro-5-methylphenyl)propanamide |
| SMILES | Cc1ccc(F)c(NC(=O)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C10H8F5NO/c1-5-2-3-6(11)7(4-5)16-9(17)10(14,15)8(12)13/h2-4,8H,1H3,(H,16,17) |
| InChIKey | ZYOVZJUWAKMGMF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|