About 2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol
2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol (PubChem CID 29957822) has the molecular formula C16H32N2O2
and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-[2-[4-(4-ethylcyclohexyl)piperazin-1-yl]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol |
| PubChem CID | 29957822 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 2-[2-[4-(4-ethylcyclohexyl)piperazin-1-yl]ethoxy]ethanol |
| SMILES | CCC1CCC(CC1)N2CCN(CC2)CCOCCO |
| InChI | InChI=1S/C16H32N2O2/c1-2-15-3-5-16(6-4-15)18-9-7-17(8-10-18)11-13-20-14-12-19/h15-16,19H,2-14H2,1H3 |
| InChIKey | XJWBIELNKCIEMP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | 247 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol?
The IUPAC name of 2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol (CID 29957822) is 2-[2-[4-(4-ethylcyclohexyl)piperazin-1-yl]ethoxy]ethanol.
What is the SMILES notation for 2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol?
The canonical SMILES for 2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol is CCC1CCC(CC1)N2CCN(CC2)CCOCCO.
What is the InChIKey of 2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol?
The InChIKey is XJWBIELNKCIEMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O2/c1-2-15-3-5-16(6-4-15)18-9-7-17(8-10-18)11-13-20-14-12-19/h15-16,19H,2-14H2,1H3.
What are the key properties of 2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol?
2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol has a molecular weight of 284.44 g/mol, XLogP of 1.80, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-{2-[4-(4-Ethylcyclohexyl)-1-piperazinyl]ethoxy}ethanol is sourced from PubChem (CID 29957822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).