About N'-ethylacetohydrazide
N'-ethylacetohydrazide (PubChem CID 29971) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is N'-ethylacetohydrazide.
Molecular Properties
| Compound Name | N'-ethylacetohydrazide |
| PubChem CID | 29971 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | N'-ethylacetohydrazide |
| SMILES | CCNNC(C)=O |
| InChI | InChI=1S/C4H10N2O/c1-3-5-6-4(2)7/h5H,3H2,1-2H3,(H,6,7) |
| InChIKey | UIWVQFSAXYWENY-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethylacetohydrazide?
The IUPAC name of N'-ethylacetohydrazide (CID 29971) is N'-ethylacetohydrazide.
What is the SMILES notation for N'-ethylacetohydrazide?
The canonical SMILES for N'-ethylacetohydrazide is CCNNC(C)=O.
What is the InChIKey of N'-ethylacetohydrazide?
The InChIKey is UIWVQFSAXYWENY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O/c1-3-5-6-4(2)7/h5H,3H2,1-2H3,(H,6,7).
What are the key properties of N'-ethylacetohydrazide?
N'-ethylacetohydrazide has a molecular weight of 102.14 g/mol, XLogP of -0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethylacetohydrazide is sourced from PubChem (CID 29971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).