C18H17F2NO4 — CID 2997146
4-(3,4-difluorophenyl)-5,6,7-trimethoxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 2997146) has the molecular formula C18H17F2NO4 and a molecular weight of 349.33 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-5,6,7-trimethoxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 4-(3,4-difluorophenyl)-5,6,7-trimethoxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 2997146 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-(3,4-difluorophenyl)-5,6,7-trimethoxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1cc2c(c(OC)c1OC)C(c1ccc(F)c(F)c1)CC(=O)N2 |
| InChI | InChI=1S/C18H17F2NO4/c1-23-14-8-13-16(18(25-3)17(14)24-2)10(7-15(22)21-13)9-4-5-11(19)12(20)6-9/h4-6,8,10H,7H2,1-3H3,(H,21,22) |
| InChIKey | PVTCMTCYGPXDPW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |