C20H16FN5O3S — CID 2997551
2-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole (PubChem CID 2997551) has the molecular formula C20H16FN5O3S and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 2997551 |
| Molecular Formula | C20H16FN5O3S |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole |
| SMILES | Cn1c(SCc2nnc(-c3ccc(F)cc3)o2)nnc1C1COc2ccccc2O1 |
| InChI | InChI=1S/C20H16FN5O3S/c1-26-18(16-10-27-14-4-2-3-5-15(14)28-16)23-25-20(26)30-11-17-22-24-19(29-17)12-6-8-13(21)9-7-12/h2-9,16H,10-11H2,1H3 |
| InChIKey | BAAOBHVTIOMRBP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |