C14H24N2 — CID 2997637
N-[2-(cyclohexen-1-yl)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 2997637) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 2997637 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | C1=C(CCNC2=NCCCCC2)CCCC1 |
| InChI | InChI=1S/C14H24N2/c1-3-7-13(8-4-1)10-12-16-14-9-5-2-6-11-15-14/h7H,1-6,8-12H2,(H,15,16) |
| InChIKey | YMNIENAYMIMJBW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|