About N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide
N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide (PubChem CID 2997733) has the molecular formula C19H28N6O
and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide |
| PubChem CID | 2997733 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide |
| SMILES | CCC1CCCCN1CC(=O)Nc1cc(C)nn1-c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C19H28N6O/c1-5-16-8-6-7-9-24(16)12-18(26)22-17-11-15(4)23-25(17)19-20-13(2)10-14(3)21-19/h10-11,16H,5-9,12H2,1-4H3,(H,22,26) |
| InChIKey | KZSQCGZLJNNWQQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide?
The IUPAC name of N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide (CID 2997733) is N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide.
What is the SMILES notation for N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide?
The canonical SMILES for N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide is CCC1CCCCN1CC(=O)Nc1cc(C)nn1-c1nc(C)cc(C)n1.
What is the InChIKey of N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide?
The InChIKey is KZSQCGZLJNNWQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N6O/c1-5-16-8-6-7-9-24(16)12-18(26)22-17-11-15(4)23-25(17)19-20-13(2)10-14(3)21-19/h10-11,16H,5-9,12H2,1-4H3,(H,22,26).
What are the key properties of N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide?
N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide has a molecular weight of 356.47 g/mol, XLogP of 2.79, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(2-ethylpiperidin-1-yl)acetamide is sourced from PubChem (CID 2997733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).