About 2-ethylsulfinylbenzoic acid
2-ethylsulfinylbenzoic acid (PubChem CID 2997876) has the molecular formula C9H10O3S
and a molecular weight of 198.24 g/mol. Its IUPAC name is 2-ethylsulfinylbenzoic acid.
Molecular Properties
| Compound Name | 2-ethylsulfinylbenzoic acid |
| PubChem CID | 2997876 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 2-ethylsulfinylbenzoic acid |
| SMILES | CCS(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C9H10O3S/c1-2-13(12)8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| InChIKey | OCMTWLNYDCQWEG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylsulfinylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfinylbenzoic acid?
The IUPAC name of 2-ethylsulfinylbenzoic acid (CID 2997876) is 2-ethylsulfinylbenzoic acid.
What is the SMILES notation for 2-ethylsulfinylbenzoic acid?
The canonical SMILES for 2-ethylsulfinylbenzoic acid is CCS(=O)c1ccccc1C(=O)O.
What is the InChIKey of 2-ethylsulfinylbenzoic acid?
The InChIKey is OCMTWLNYDCQWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3S/c1-2-13(12)8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3,(H,10,11).
What are the key properties of 2-ethylsulfinylbenzoic acid?
2-ethylsulfinylbenzoic acid has a molecular weight of 198.24 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfinylbenzoic acid is sourced from PubChem (CID 2997876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).