C15H22N7P — CID 2997957
3-N,3-N,3-N',3-N',9-pentamethyl-5-phenyl-2,4,8,9-tetraza-3lambda5-phosphabicyclo[4.3.0]nona-1(6),2,4,7-tetraene-3,3,7-triamine (PubChem CID 2997957) has the molecular formula C15H22N7P and a molecular weight of 331.36 g/mol. Its IUPAC name is 3-N,3-N,3-N',3-N',9-pentamethyl-5-phenyl-2,4,8,9-tetraza-3lambda5-phosphabicyclo[4.3.0]nona-1(6),2,4,7-tetraene-3,3,7-triamine.
| Compound Name | 3-N,3-N,3-N',3-N',9-pentamethyl-5-phenyl-2,4,8,9-tetraza-3lambda5-phosphabicyclo[4.3.0]nona-1(6),2,4,7-tetraene-3,3,7-triamine |
|---|---|
| PubChem CID | 2997957 |
| Molecular Formula | C15H22N7P |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 3-N,3-N,3-N',3-N',9-pentamethyl-5-phenyl-2,4,8,9-tetraza-3lambda5-phosphabicyclo[4.3.0]nona-1(6),2,4,7-tetraene-3,3,7-triamine |
| SMILES | CN(C)P1(N(C)C)=Nc2c(c(N)nn2C)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C15H22N7P/c1-20(2)23(21(3)4)18-13(11-9-7-6-8-10-11)12-14(16)17-22(5)15(12)19-23/h6-10H,1-5H3,(H2,16,17) |
| InChIKey | PTJKNOMFJNFJOL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|