C22H36N2O8 — CID 2997994
ethyl 4-[3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;oxalic acid (PubChem CID 2997994) has the molecular formula C22H36N2O8 and a molecular weight of 456.54 g/mol. Its IUPAC name is ethyl 4-[3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;oxalic acid.
| Compound Name | ethyl 4-[3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 2997994 |
| Molecular Formula | C22H36N2O8 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | ethyl 4-[3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;oxalic acid |
| SMILES | CCOC(=O)N1CCN(CC(O)COCC2=CCC3CC2C3(C)C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H34N2O4.C2H2O4/c1-4-26-19(24)22-9-7-21(8-10-22)12-17(23)14-25-13-15-5-6-16-11-18(15)20(16,2)3;3-1(4)2(5)6/h5,16-18,23H,4,6-14H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | HFDDTZQHKRLOHR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|