C16H17N5O3S2 — CID 2998048
2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide (PubChem CID 2998048) has the molecular formula C16H17N5O3S2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide.
| Compound Name | 2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 2998048 |
| Molecular Formula | C16H17N5O3S2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
| SMILES | Nn1cc(-c2ccccc2)nc1SCC(=O)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C16H17N5O3S2/c17-21-8-12(11-4-2-1-3-5-11)19-15(21)25-9-13(22)18-6-7-20-14(23)10-26-16(20)24/h1-5,8H,6-7,9-10,17H2,(H,18,22) |
| InChIKey | HSQGPMVTQYQJOZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|