About [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate (PubChem CID 2998171) has the molecular formula C19H19NO6S
and a molecular weight of 389.43 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate |
| PubChem CID | 2998171 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Oc1ccccc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19NO6S/c21-18(20-14-10-11-27(23,24)13-14)12-25-19(22)16-8-4-5-9-17(16)26-15-6-2-1-3-7-15/h1-9,14H,10-13H2,(H,20,21) |
| InChIKey | SSJOTZDBPOGLQQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate (CID 2998171) is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate is O=C(COC(=O)c1ccccc1Oc1ccccc1)NC1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate?
The InChIKey is SSJOTZDBPOGLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO6S/c21-18(20-14-10-11-27(23,24)13-14)12-25-19(22)16-8-4-5-9-17(16)26-15-6-2-1-3-7-15/h1-9,14H,10-13H2,(H,20,21).
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate?
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate has a molecular weight of 389.43 g/mol, XLogP of 1.94, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-phenoxybenzoate is sourced from PubChem (CID 2998171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).