C14H18N2O — CID 2998281
1',3,3',3'-tetramethylspiro[4H-1,2-oxazole-5,2'-indole] (PubChem CID 2998281) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1',3,3',3'-tetramethylspiro[4H-1,2-oxazole-5,2'-indole].
| Compound Name | 1',3,3',3'-tetramethylspiro[4H-1,2-oxazole-5,2'-indole] |
|---|---|
| PubChem CID | 2998281 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1',3,3',3'-tetramethylspiro[4H-1,2-oxazole-5,2'-indole] |
| SMILES | CC1=NOC2(C1)N(C)c1ccccc1C2(C)C |
| InChI | InChI=1S/C14H18N2O/c1-10-9-14(17-15-10)13(2,3)11-7-5-6-8-12(11)16(14)4/h5-8H,9H2,1-4H3 |
| InChIKey | GHTQMJHSIVKCMG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |