About [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate (PubChem CID 2998312) has the molecular formula C20H22N2O5S
and a molecular weight of 402.47 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate |
| PubChem CID | 2998312 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccccc1Nc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H22N2O5S/c1-22(16-11-12-28(25,26)14-16)19(23)13-27-20(24)17-9-5-6-10-18(17)21-15-7-3-2-4-8-15/h2-10,16,21H,11-14H2,1H3 |
| InChIKey | KRJVKSXXORFCAF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate (CID 2998312) is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate is CN(C(=O)COC(=O)c1ccccc1Nc1ccccc1)C1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate?
The InChIKey is KRJVKSXXORFCAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O5S/c1-22(16-11-12-28(25,26)14-16)19(23)13-27-20(24)17-9-5-6-10-18(17)21-15-7-3-2-4-8-15/h2-10,16,21H,11-14H2,1H3.
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate?
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate has a molecular weight of 402.47 g/mol, XLogP of 2.23, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-anilinobenzoate is sourced from PubChem (CID 2998312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).