About (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate
(4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate (PubChem CID 2998411) has the molecular formula C18H25NO3
and a molecular weight of 303.40 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate |
| PubChem CID | 2998411 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1COC(=O)C1CCC(=O)N1 |
| InChI | InChI=1S/C18H25NO3/c1-11-8-13(18(3,4)5)9-12(2)14(11)10-22-17(21)15-6-7-16(20)19-15/h8-9,15H,6-7,10H2,1-5H3,(H,19,20) |
| InChIKey | VYTIXNRCBXDAIV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate?
The IUPAC name of (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate (CID 2998411) is (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate.
What is the SMILES notation for (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate?
The canonical SMILES for (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate is Cc1cc(C(C)(C)C)cc(C)c1COC(=O)C1CCC(=O)N1.
What is the InChIKey of (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate?
The InChIKey is VYTIXNRCBXDAIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO3/c1-11-8-13(18(3,4)5)9-12(2)14(11)10-22-17(21)15-6-7-16(20)19-15/h8-9,15H,6-7,10H2,1-5H3,(H,19,20).
What are the key properties of (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate?
(4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate has a molecular weight of 303.40 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butyl-2,6-dimethylphenyl)methyl 5-oxopyrrolidine-2-carboxylate is sourced from PubChem (CID 2998411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).