About ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate
ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate (PubChem CID 2998417) has the molecular formula C20H20N2O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate |
| PubChem CID | 2998417 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC1CC(=O)N(c2ccccc2C)C1=O |
| InChI | InChI=1S/C20H20N2O4/c1-3-26-20(25)14-9-5-6-10-15(14)21-16-12-18(23)22(19(16)24)17-11-7-4-8-13(17)2/h4-11,16,21H,3,12H2,1-2H3 |
| InChIKey | NLUQPONVSRQAAU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate?
The IUPAC name of ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate (CID 2998417) is ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate.
What is the SMILES notation for ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate?
The canonical SMILES for ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate is CCOC(=O)c1ccccc1NC1CC(=O)N(c2ccccc2C)C1=O.
What is the InChIKey of ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate?
The InChIKey is NLUQPONVSRQAAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4/c1-3-26-20(25)14-9-5-6-10-15(14)21-16-12-18(23)22(19(16)24)17-11-7-4-8-13(17)2/h4-11,16,21H,3,12H2,1-2H3.
What are the key properties of ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate?
ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate has a molecular weight of 352.39 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]benzoate is sourced from PubChem (CID 2998417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).