C10H13NO4S2 — CID 2998518
ethyl 2-amino-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate (PubChem CID 2998518) has the molecular formula C10H13NO4S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethyl 2-amino-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate.
| Compound Name | ethyl 2-amino-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate |
|---|---|
| PubChem CID | 2998518 |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | ethyl 2-amino-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1CCS(=O)(=O)C2 |
| InChI | InChI=1S/C10H13NO4S2/c1-2-15-10(12)8-6-3-4-17(13,14)5-7(6)16-9(8)11/h2-5,11H2,1H3 |
| InChIKey | QXEOGEHYHZTZCA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|