About ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate
ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate (PubChem CID 2998529) has the molecular formula C18H18N4O2S2
and a molecular weight of 386.50 g/mol. Its IUPAC name is ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate |
| PubChem CID | 2998529 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(SCc1cn3ccsc3n1)n2CC |
| InChI | InChI=1S/C18H18N4O2S2/c1-3-22-15-6-5-12(16(23)24-4-2)9-14(15)20-18(22)26-11-13-10-21-7-8-25-17(21)19-13/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | SUADLPFURMFDRS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate?
The IUPAC name of ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate (CID 2998529) is ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate.
What is the SMILES notation for ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate?
The canonical SMILES for ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate is CCOC(=O)c1ccc2c(c1)nc(SCc1cn3ccsc3n1)n2CC.
What is the InChIKey of ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate?
The InChIKey is SUADLPFURMFDRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O2S2/c1-3-22-15-6-5-12(16(23)24-4-2)9-14(15)20-18(22)26-11-13-10-21-7-8-25-17(21)19-13/h5-10H,3-4,11H2,1-2H3.
What are the key properties of ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate?
ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate has a molecular weight of 386.50 g/mol, XLogP of 4.23, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)benzimidazole-5-carboxylate is sourced from PubChem (CID 2998529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).