C20H20FN5O2S — CID 2998638
3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one (PubChem CID 2998638) has the molecular formula C20H20FN5O2S and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one.
| Compound Name | 3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one |
|---|---|
| PubChem CID | 2998638 |
| Molecular Formula | C20H20FN5O2S |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one |
| SMILES | Cc1cc(C)n2nc(SC3CCCCN(C(=O)c4ccc(F)cc4)C3=O)nc2n1 |
| InChI | InChI=1S/C20H20FN5O2S/c1-12-11-13(2)26-19(22-12)23-20(24-26)29-16-5-3-4-10-25(18(16)28)17(27)14-6-8-15(21)9-7-14/h6-9,11,16H,3-5,10H2,1-2H3 |
| InChIKey | SMVNGSKFQQCMEY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|