About 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one
2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 2998642) has the molecular formula C11H13NO3S
and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one |
| PubChem CID | 2998642 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C2NC(=O)CS2)cc1OC |
| InChI | InChI=1S/C11H13NO3S/c1-14-8-4-3-7(5-9(8)15-2)11-12-10(13)6-16-11/h3-5,11H,6H2,1-2H3,(H,12,13) |
| InChIKey | DKHGYGOTSRVLMZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one (CID 2998642) is 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one is COc1ccc(C2NC(=O)CS2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one?
The InChIKey is DKHGYGOTSRVLMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3S/c1-14-8-4-3-7(5-9(8)15-2)11-12-10(13)6-16-11/h3-5,11H,6H2,1-2H3,(H,12,13).
What are the key properties of 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one?
2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one has a molecular weight of 239.30 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 2998642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).