About [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate
[2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 2998659) has the molecular formula C18H23NO4
and a molecular weight of 317.38 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate.
Molecular Properties
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate |
| PubChem CID | 2998659 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(C3)C1)C2)NCc1ccco1 |
| InChI | InChI=1S/C18H23NO4/c20-16(19-10-15-2-1-3-22-15)11-23-17(21)18-7-12-4-13(8-18)6-14(5-12)9-18/h1-3,12-14H,4-11H2,(H,19,20) |
| InChIKey | MOSOSUPDUHNNDQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate?
The IUPAC name of [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate (CID 2998659) is [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate.
What is the SMILES notation for [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate?
The canonical SMILES for [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate is O=C(COC(=O)C12CC3CC(CC(C3)C1)C2)NCc1ccco1.
What is the InChIKey of [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate?
The InChIKey is MOSOSUPDUHNNDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO4/c20-16(19-10-15-2-1-3-22-15)11-23-17(21)18-7-12-4-13(8-18)6-14(5-12)9-18/h1-3,12-14H,4-11H2,(H,19,20).
What are the key properties of [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate?
[2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate has a molecular weight of 317.38 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(furan-2-ylmethylamino)-2-oxoethyl] adamantane-1-carboxylate is sourced from PubChem (CID 2998659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).