About 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide (PubChem CID 2998992) has the molecular formula C22H19N5O5
and a molecular weight of 433.42 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide |
| PubChem CID | 2998992 |
| Molecular Formula | C22H19N5O5 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide |
| SMILES | COc1cc2c(cc1NC(=O)Cn1cnc3c1c(=O)n(C)c(=O)n3C)oc1ccccc12 |
| InChI | InChI=1S/C22H19N5O5/c1-25-20-19(21(29)26(2)22(25)30)27(11-23-20)10-18(28)24-14-9-16-13(8-17(14)31-3)12-6-4-5-7-15(12)32-16/h4-9,11H,10H2,1-3H3,(H,24,28) |
| InChIKey | HSANNRKGAZVNFS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide?
The IUPAC name of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide (CID 2998992) is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide.
What is the SMILES notation for 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide?
The canonical SMILES for 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide is COc1cc2c(cc1NC(=O)Cn1cnc3c1c(=O)n(C)c(=O)n3C)oc1ccccc12.
What is the InChIKey of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide?
The InChIKey is HSANNRKGAZVNFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N5O5/c1-25-20-19(21(29)26(2)22(25)30)27(11-23-20)10-18(28)24-14-9-16-13(8-17(14)31-3)12-6-4-5-7-15(12)32-16/h4-9,11H,10H2,1-3H3,(H,24,28).
What are the key properties of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide?
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide has a molecular weight of 433.42 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxydibenzofuran-3-yl)acetamide is sourced from PubChem (CID 2998992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).