About (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate
(3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate (PubChem CID 2999072) has the molecular formula C16H13BrN2O3
and a molecular weight of 361.20 g/mol. Its IUPAC name is (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate.
Molecular Properties
| Compound Name | (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate |
| PubChem CID | 2999072 |
| Molecular Formula | C16H13BrN2O3 |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate |
| SMILES | O=C(OCC1CC(c2ccccn2)=NO1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H13BrN2O3/c17-12-6-4-11(5-7-12)16(20)21-10-13-9-15(19-22-13)14-3-1-2-8-18-14/h1-8,13H,9-10H2 |
| InChIKey | PFMFMPNTPFQDIG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate?
The IUPAC name of (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate (CID 2999072) is (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate.
What is the SMILES notation for (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate?
The canonical SMILES for (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate is O=C(OCC1CC(c2ccccn2)=NO1)c1ccc(Br)cc1.
What is the InChIKey of (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate?
The InChIKey is PFMFMPNTPFQDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrN2O3/c17-12-6-4-11(5-7-12)16(20)21-10-13-9-15(19-22-13)14-3-1-2-8-18-14/h1-8,13H,9-10H2.
What are the key properties of (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate?
(3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate has a molecular weight of 361.20 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate is sourced from PubChem (CID 2999072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).