About [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate
[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate (PubChem CID 2999073) has the molecular formula C16H23NO4
and a molecular weight of 293.36 g/mol. Its IUPAC name is [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate.
Molecular Properties
| Compound Name | [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate |
| PubChem CID | 2999073 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)N2C(C)CCCC2C)c(C)o1 |
| InChI | InChI=1S/C16H23NO4/c1-10-6-5-7-11(2)17(10)15(18)9-20-16(19)14-8-12(3)21-13(14)4/h8,10-11H,5-7,9H2,1-4H3 |
| InChIKey | PXXMGPRGFYCUSR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate?
The IUPAC name of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate (CID 2999073) is [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate.
What is the SMILES notation for [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate?
The canonical SMILES for [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate is Cc1cc(C(=O)OCC(=O)N2C(C)CCCC2C)c(C)o1.
What is the InChIKey of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate?
The InChIKey is PXXMGPRGFYCUSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO4/c1-10-6-5-7-11(2)17(10)15(18)9-20-16(19)14-8-12(3)21-13(14)4/h8,10-11H,5-7,9H2,1-4H3.
What are the key properties of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate?
[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate has a molecular weight of 293.36 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate is sourced from PubChem (CID 2999073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).