C21H24N2O5S — CID 2999341
N-benzyl-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 2999341) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-benzyl-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-benzyl-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 2999341 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-benzyl-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C1C2CC=CCC2C(=O)N1CC(=O)N(Cc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H24N2O5S/c24-19(13-23-20(25)17-8-4-5-9-18(17)21(23)26)22(12-15-6-2-1-3-7-15)16-10-11-29(27,28)14-16/h1-7,16-18H,8-14H2 |
| InChIKey | CRUAVMBGZIJEQG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|