About 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine
3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine (PubChem CID 2999435) has the molecular formula C18H27N4OP
and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine |
| PubChem CID | 2999435 |
| Molecular Formula | C18H27N4OP |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1nc2ccccn2c1P(=O)(N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C18H27N4OP/c1-16-18(22-15-9-4-10-17(22)19-16)24(23,20-11-5-2-6-12-20)21-13-7-3-8-14-21/h4,9-10,15H,2-3,5-8,11-14H2,1H3 |
| InChIKey | OLXOQASLIJOMER-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine?
The IUPAC name of 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine (CID 2999435) is 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine.
What is the SMILES notation for 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine?
The canonical SMILES for 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine is Cc1nc2ccccn2c1P(=O)(N1CCCCC1)N1CCCCC1.
What is the InChIKey of 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine?
The InChIKey is OLXOQASLIJOMER-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N4OP/c1-16-18(22-15-9-4-10-17(22)19-16)24(23,20-11-5-2-6-12-20)21-13-7-3-8-14-21/h4,9-10,15H,2-3,5-8,11-14H2,1H3.
What are the key properties of 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine?
3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine has a molecular weight of 346.41 g/mol, XLogP of 3.43, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-di(piperidin-1-yl)phosphoryl-2-methylimidazo[1,2-a]pyridine is sourced from PubChem (CID 2999435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).