C17H12F3NO2 — CID 2999612
15-hydroxy-15-(trifluoromethyl)-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaen-16-one (PubChem CID 2999612) has the molecular formula C17H12F3NO2 and a molecular weight of 319.28 g/mol. Its IUPAC name is 15-hydroxy-15-(trifluoromethyl)-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaen-16-one.
| Compound Name | 15-hydroxy-15-(trifluoromethyl)-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaen-16-one |
|---|---|
| PubChem CID | 2999612 |
| Molecular Formula | C17H12F3NO2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 15-hydroxy-15-(trifluoromethyl)-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaen-16-one |
| SMILES | O=C1N2c3ccccc3CCc3cccc(c32)C1(O)C(F)(F)F |
| InChI | InChI=1S/C17H12F3NO2/c18-17(19,20)16(23)12-6-3-5-11-9-8-10-4-1-2-7-13(10)21(14(11)12)15(16)22/h1-7,23H,8-9H2 |
| InChIKey | NLNATMYORVUROW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |