C11H13N3S — CID 2999708
N'-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 2999708) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N'-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 2999708 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N'-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1sc2c(c1C#N)CCC2 |
| InChI | InChI=1S/C11H13N3S/c1-14(2)7-13-11-9(6-12)8-4-3-5-10(8)15-11/h7H,3-5H2,1-2H3 |
| InChIKey | LMUYFGDTLHZRRW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|