C19H16N4O — CID 2999839
4-(4-methoxyphenyl)-1,5,6,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,4,9,11,13,15-hexaene (PubChem CID 2999839) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,5,6,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,4,9,11,13,15-hexaene.
| Compound Name | 4-(4-methoxyphenyl)-1,5,6,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,4,9,11,13,15-hexaene |
|---|---|
| PubChem CID | 2999839 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,5,6,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,4,9,11,13,15-hexaene |
| SMILES | COc1ccc(-c2cc3n(n2)CCc2nc4ccccc4n2-3)cc1 |
| InChI | InChI=1S/C19H16N4O/c1-24-14-8-6-13(7-9-14)16-12-19-22(21-16)11-10-18-20-15-4-2-3-5-17(15)23(18)19/h2-9,12H,10-11H2,1H3 |
| InChIKey | CISJKMSWAPXOGX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |