C18H21N3O3S — CID 2999861
N-(3-acetylphenyl)-2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetamide (PubChem CID 2999861) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-(3-acetylphenyl)-2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 2999861 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(3-acetylphenyl)-2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CC2SC(N3CCCCC3)=NC2=O)c1 |
| InChI | InChI=1S/C18H21N3O3S/c1-12(22)13-6-5-7-14(10-13)19-16(23)11-15-17(24)20-18(25-15)21-8-3-2-4-9-21/h5-7,10,15H,2-4,8-9,11H2,1H3,(H,19,23) |
| InChIKey | UYWIRUMRINNODQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |