C13H12N2O2S — CID 2999932
3-(furan-2-ylmethyl)-2-pyridin-4-yl-1,3-thiazolidin-4-one (PubChem CID 2999932) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-2-pyridin-4-yl-1,3-thiazolidin-4-one.
| Compound Name | 3-(furan-2-ylmethyl)-2-pyridin-4-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2999932 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-(furan-2-ylmethyl)-2-pyridin-4-yl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccncc2)N1Cc1ccco1 |
| InChI | InChI=1S/C13H12N2O2S/c16-12-9-18-13(10-3-5-14-6-4-10)15(12)8-11-2-1-7-17-11/h1-7,13H,8-9H2 |
| InChIKey | VKDSHINGPZODLR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |