C20H17BrN4O3 — CID 2999998
3-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 2999998) has the molecular formula C20H17BrN4O3 and a molecular weight of 441.29 g/mol. Its IUPAC name is 3-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2999998 |
| Molecular Formula | C20H17BrN4O3 |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 3-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(CCc2ccccc2)C(=O)N1Cc1nnc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C20H17BrN4O3/c21-15-9-5-4-8-14(15)18-24-23-17(28-18)12-25-19(26)16(22-20(25)27)11-10-13-6-2-1-3-7-13/h1-9,16H,10-12H2,(H,22,27) |
| InChIKey | AUXRHNBPHRWEMR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|