About 2H-indole
2H-indole (PubChem CID 19013146) has the molecular formula C8H7N
and a molecular weight of 117.15 g/mol. Its IUPAC name is 2H-indole.
Molecular Properties
| Compound Name | 2H-indole |
| PubChem CID | 19013146 |
| Molecular Formula | C8H7N |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 2H-indole |
| SMILES | C1=c2ccccc2=NC1 |
| InChI | InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-5H,6H2 |
| InChIKey | KHSACZVQYSVGDJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-indole?
The IUPAC name of 2H-indole (CID 19013146) is 2H-indole.
What is the SMILES notation for 2H-indole?
The canonical SMILES for 2H-indole is C1=c2ccccc2=NC1.
What is the InChIKey of 2H-indole?
The InChIKey is KHSACZVQYSVGDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-5H,6H2.
What are the key properties of 2H-indole?
2H-indole has a molecular weight of 117.15 g/mol, XLogP of 0.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-indole is sourced from PubChem (CID 19013146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).