About 3-anilinophenol
3-anilinophenol (PubChem CID 7546) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-anilinophenol.
Molecular Properties
| Compound Name | 3-anilinophenol |
| PubChem CID | 7546 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 3-anilinophenol |
| SMILES | Oc1cccc(Nc2ccccc2)c1 |
| InChI | InChI=1S/C12H11NO/c14-12-8-4-7-11(9-12)13-10-5-2-1-3-6-10/h1-9,13-14H |
| InChIKey | NDACNGSDAFKTGE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-anilinophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilinophenol?
The IUPAC name of 3-anilinophenol (CID 7546) is 3-anilinophenol.
What is the SMILES notation for 3-anilinophenol?
The canonical SMILES for 3-anilinophenol is Oc1cccc(Nc2ccccc2)c1.
What is the InChIKey of 3-anilinophenol?
The InChIKey is NDACNGSDAFKTGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c14-12-8-4-7-11(9-12)13-10-5-2-1-3-6-10/h1-9,13-14H.
What are the key properties of 3-anilinophenol?
3-anilinophenol has a molecular weight of 185.23 g/mol, XLogP of 3.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilinophenol is sourced from PubChem (CID 7546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).