About 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide (PubChem CID 3000031) has the molecular formula C19H19N7O3
and a molecular weight of 393.41 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide |
| PubChem CID | 3000031 |
| Molecular Formula | C19H19N7O3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H19N7O3/c1-12-9-14(26(22-12)13-7-5-4-6-8-13)21-15(27)10-25-11-20-17-16(25)18(28)24(3)19(29)23(17)2/h4-9,11H,10H2,1-3H3,(H,21,27) |
| InChIKey | FOWIXTXGHZOBNQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide?
The IUPAC name of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide (CID 3000031) is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide.
What is the SMILES notation for 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide?
The canonical SMILES for 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide is Cc1cc(NC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)n(-c2ccccc2)n1.
What is the InChIKey of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide?
The InChIKey is FOWIXTXGHZOBNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N7O3/c1-12-9-14(26(22-12)13-7-5-4-6-8-13)21-15(27)10-25-11-20-17-16(25)18(28)24(3)19(29)23(17)2/h4-9,11H,10H2,1-3H3,(H,21,27).
What are the key properties of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide?
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide has a molecular weight of 393.41 g/mol, XLogP of 0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide is sourced from PubChem (CID 3000031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).